C30H35N3O9 — CID 90943041
(2R)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(2-ethoxy-2-oxoethyl)amino]-2,3-diethylbutanedioic acid (PubChem CID 90943041) has the molecular formula C30H35N3O9 and a molecular weight of 581.62 g/mol. Its IUPAC name is (2R)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(2-ethoxy-2-oxoethyl)amino]-2,3-diethylbutanedioic acid.
| Compound Name | (2R)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(2-ethoxy-2-oxoethyl)amino]-2,3-diethylbutanedioic acid |
|---|---|
| PubChem CID | 90943041 |
| Molecular Formula | C30H35N3O9 |
| Molecular Weight | 581.62 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2R)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(2-ethoxy-2-oxoethyl)amino]-2,3-diethylbutanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)N(CC(=O)OCC)[C@@](CC)(C(=O)O)C(CC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H35N3O9/c1-5-23(27(36)37)30(6-2,29(39)40)33(17-24(34)41-7-3)26(35)18(4)16-19-8-10-21(11-9-19)28(38)42-22-14-12-20(13-15-22)25(31)32/h8-16,23H,5-7,17H2,1-4H3,(H3,31,32)(H,36,37)(H,39,40)/t23?,30-/m1/s1 |
| InChIKey | HMJWAHDECBWZIZ-JSTCWRMYSA-N |
| XLogP | 3.33 |
| TPSA | 197.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.62 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|