C32H37N3O9 — CID 91380171
(2S)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(4-ethoxy-4-oxobut-2-enyl)amino]-2,3-diethylbutanedioic acid (PubChem CID 91380171) has the molecular formula C32H37N3O9 and a molecular weight of 607.66 g/mol. Its IUPAC name is (2S)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(4-ethoxy-4-oxobut-2-enyl)amino]-2,3-diethylbutanedioic acid.
| Compound Name | (2S)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(4-ethoxy-4-oxobut-2-enyl)amino]-2,3-diethylbutanedioic acid |
|---|---|
| PubChem CID | 91380171 |
| Molecular Formula | C32H37N3O9 |
| Molecular Weight | 607.66 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | (2S)-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-(4-ethoxy-4-oxobut-2-enyl)amino]-2,3-diethylbutanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)N(CC=CC(=O)OCC)[C@](CC)(C(=O)O)C(CC)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C32H37N3O9/c1-5-25(29(38)39)32(6-2,31(41)42)35(18-8-9-26(36)43-7-3)28(37)20(4)19-21-10-12-23(13-11-21)30(40)44-24-16-14-22(15-17-24)27(33)34/h8-17,19,25H,5-7,18H2,1-4H3,(H3,33,34)(H,38,39)(H,41,42)/t25?,32-/m0/s1 |
| InChIKey | CNIUTWLUVCJNTD-WYYRYWFOSA-N |
| XLogP | 3.89 |
| TPSA | 197.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.66 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|