C27H34ClN3O6 — CID 67640455
(4-carbamimidoylphenyl) 4-[3-[(3-ethoxy-3-oxopropyl)-(3-methoxypropyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate;hydrochloride (PubChem CID 67640455) has the molecular formula C27H34ClN3O6 and a molecular weight of 532.04 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 4-[3-[(3-ethoxy-3-oxopropyl)-(3-methoxypropyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate;hydrochloride.
| Compound Name | (4-carbamimidoylphenyl) 4-[3-[(3-ethoxy-3-oxopropyl)-(3-methoxypropyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 67640455 |
| Molecular Formula | C27H34ClN3O6 |
| Molecular Weight | 532.04 g/mol |
| Exact Mass | 531.21 |
| IUPAC Name | (4-carbamimidoylphenyl) 4-[3-[(3-ethoxy-3-oxopropyl)-(3-methoxypropyl)amino]-2-methyl-3-oxoprop-1-enyl]benzoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)N(CCCOC)CCC(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C27H33N3O6.ClH/c1-4-35-24(31)14-16-30(15-5-17-34-3)26(32)19(2)18-20-6-8-22(9-7-20)27(33)36-23-12-10-21(11-13-23)25(28)29;/h6-13,18H,4-5,14-17H2,1-3H3,(H3,28,29);1H |
| InChIKey | ZIOYMZXFKAEHIA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 132.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|