About (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride
(4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride (PubChem CID 138961462) has the molecular formula C15H15ClN2O3
and a molecular weight of 306.75 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride |
| PubChem CID | 138961462 |
| Molecular Formula | C15H15ClN2O3 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C15H14N2O3.ClH/c1-19-12-6-4-11(5-7-12)15(18)20-13-8-2-10(3-9-13)14(16)17;/h2-9H,1H3,(H3,16,17);1H |
| InChIKey | QAXGQJQFSVHATC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride?
The IUPAC name of (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride (CID 138961462) is (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride.
What is the SMILES notation for (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride?
The canonical SMILES for (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride is Cl.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(OC)cc2)cc1.
What is the InChIKey of (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride?
The InChIKey is QAXGQJQFSVHATC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3.ClH/c1-19-12-6-4-11(5-7-12)15(18)20-13-8-2-10(3-9-13)14(16)17;/h2-9H,1H3,(H3,16,17);1H.
What are the key properties of (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride?
(4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride has a molecular weight of 306.75 g/mol, XLogP of 2.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamimidoylphenyl) 4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 138961462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).