C27H32N4O6 — CID 90748429
(2S)-5-amino-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-2-ethyl-5-oxopentanoic acid (PubChem CID 90748429) has the molecular formula C27H32N4O6 and a molecular weight of 508.58 g/mol. Its IUPAC name is (2S)-5-amino-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-2-ethyl-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-2-ethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 90748429 |
| Molecular Formula | C27H32N4O6 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | (2S)-5-amino-2-[[3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]-ethylamino]-2-ethyl-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(C=C(C)C(=O)N(CC)[C@@](CC)(CCC(N)=O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O6/c1-4-27(26(35)36,15-14-22(28)32)31(5-2)24(33)17(3)16-18-6-8-20(9-7-18)25(34)37-21-12-10-19(11-13-21)23(29)30/h6-13,16H,4-5,14-15H2,1-3H3,(H2,28,32)(H3,29,30)(H,35,36)/t27-/m0/s1 |
| InChIKey | ZEHACYKVSNHREJ-MHZLTWQESA-N |
| XLogP | 2.94 |
| TPSA | 176.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|