C32H33N3O7S — CID 68564726
ethyl 2-[(2R)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-3-ethoxy-3-oxopropyl]sulfanylbenzoate (PubChem CID 68564726) has the molecular formula C32H33N3O7S and a molecular weight of 603.70 g/mol. Its IUPAC name is ethyl 2-[(2R)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-3-ethoxy-3-oxopropyl]sulfanylbenzoate.
| Compound Name | ethyl 2-[(2R)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-3-ethoxy-3-oxopropyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 68564726 |
| Molecular Formula | C32H33N3O7S |
| Molecular Weight | 603.70 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | ethyl 2-[(2R)-2-[[(E)-3-[4-(4-carbamimidoylphenoxy)carbonylphenyl]-2-methylprop-2-enoyl]amino]-3-ethoxy-3-oxopropyl]sulfanylbenzoate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(/C=C(\C)C(=O)N[C@@H](CSc3ccccc3C(=O)OCC)C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C32H33N3O7S/c1-4-40-31(38)25-8-6-7-9-27(25)43-19-26(32(39)41-5-2)35-29(36)20(3)18-21-10-12-23(13-11-21)30(37)42-24-16-14-22(15-17-24)28(33)34/h6-18,26H,4-5,19H2,1-3H3,(H3,33,34)(H,35,36)/b20-18+/t26-/m0/s1 |
| InChIKey | WNYMQOZLNAULHF-IZWLMUMNSA-N |
| XLogP | 4.61 |
| TPSA | 157.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.70 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|