C15H24N4O — CID 61301165
4-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]benzenecarboximidamide (PubChem CID 61301165) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]benzenecarboximidamide.
| Compound Name | 4-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 61301165 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[2-(4-methyl-1,4-diazepan-1-yl)ethoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCN2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H24N4O/c1-18-7-2-8-19(10-9-18)11-12-20-14-5-3-13(4-6-14)15(16)17/h3-6H,2,7-12H2,1H3,(H3,16,17) |
| InChIKey | PTCUJYBTOLJXCA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|