C18H25N3O4 — CID 54505197
2-[1-[1-(4-carbamimidoylphenyl)-1-oxobutan-2-yl]piperidin-4-yl]oxyacetic acid (PubChem CID 54505197) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[1-[1-(4-carbamimidoylphenyl)-1-oxobutan-2-yl]piperidin-4-yl]oxyacetic acid.
| Compound Name | 2-[1-[1-(4-carbamimidoylphenyl)-1-oxobutan-2-yl]piperidin-4-yl]oxyacetic acid |
|---|---|
| PubChem CID | 54505197 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 2-[1-[1-(4-carbamimidoylphenyl)-1-oxobutan-2-yl]piperidin-4-yl]oxyacetic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)C(CC)N2CCC(OCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O4/c1-2-15(17(24)12-3-5-13(6-4-12)18(19)20)21-9-7-14(8-10-21)25-11-16(22)23/h3-6,14-15H,2,7-11H2,1H3,(H3,19,20)(H,22,23) |
| InChIKey | YFEOKSSKDDNDLR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|