C31H30N6O8 — CID 57194528
(3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-benzyl-4-[4-(diazenylmethyl)phenyl]-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid (PubChem CID 57194528) has the molecular formula C31H30N6O8 and a molecular weight of 614.62 g/mol. Its IUPAC name is (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-benzyl-4-[4-(diazenylmethyl)phenyl]-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-benzyl-4-[4-(diazenylmethyl)phenyl]-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57194528 |
| Molecular Formula | C31H30N6O8 |
| Molecular Weight | 614.62 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | (3S)-3-amino-4-(N-[(2S)-1-[(4R)-4-benzyl-4-[4-(diazenylmethyl)phenyl]-2,5-dioxoimidazolidin-1-yl]oxy-1,3-dioxobutan-2-yl]anilino)-4-oxobutanoic acid |
| SMILES | [H]/N=N/Cc1ccc([C@@]2(Cc3ccccc3)NC(=O)N(OC(=O)[C@H](C(C)=O)N(C(=O)[C@@H](N)CC(=O)O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C31H30N6O8/c1-19(38)26(36(23-10-6-3-7-11-23)27(41)24(32)16-25(39)40)28(42)45-37-29(43)31(35-30(37)44,17-20-8-4-2-5-9-20)22-14-12-21(13-15-22)18-34-33/h2-15,24,26,33H,16-18,32H2,1H3,(H,35,44)(H,39,40)/b34-33+/t24-,26-,31+/m0/s1 |
| InChIKey | NPQVQZGZNUHXLT-YIMYVWTISA-N |
| XLogP | 2.46 |
| TPSA | 212.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.62 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|