C23H26N6O5 — CID 57154659
(2S)-3-[acetyl-[(4R)-3-benzyl-4-[4-(diazenylmethyl)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-aminopropanoic acid (PubChem CID 57154659) has the molecular formula C23H26N6O5 and a molecular weight of 466.50 g/mol. Its IUPAC name is (2S)-3-[acetyl-[(4R)-3-benzyl-4-[4-(diazenylmethyl)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-aminopropanoic acid.
| Compound Name | (2S)-3-[acetyl-[(4R)-3-benzyl-4-[4-(diazenylmethyl)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-aminopropanoic acid |
|---|---|
| PubChem CID | 57154659 |
| Molecular Formula | C23H26N6O5 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | (2S)-3-[acetyl-[(4R)-3-benzyl-4-[4-(diazenylmethyl)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]amino]-2-aminopropanoic acid |
| SMILES | [H]/N=N/Cc1ccc([C@]2(C)C(=O)N(N(C[C@H](N)C(=O)O)C(C)=O)C(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26N6O5/c1-15(30)28(14-19(24)20(31)32)29-21(33)23(2,18-10-8-16(9-11-18)12-26-25)27(22(29)34)13-17-6-4-3-5-7-17/h3-11,19,25H,12-14,24H2,1-2H3,(H,31,32)/b26-25+/t19-,23+/m0/s1 |
| InChIKey | LPMWOBNKGYUWAG-OKHMVZRGSA-N |
| XLogP | 2.07 |
| TPSA | 160.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|