C27H30N6O8 — CID 57093916
(2S,3S)-3-amino-4-[N-(carboxymethyl)anilino]-2-[2-[(4R)-4-[4-(diazenylmethyl)phenyl]-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-4-oxobutanoic acid (PubChem CID 57093916) has the molecular formula C27H30N6O8 and a molecular weight of 566.57 g/mol. Its IUPAC name is (2S,3S)-3-amino-4-[N-(carboxymethyl)anilino]-2-[2-[(4R)-4-[4-(diazenylmethyl)phenyl]-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-4-oxobutanoic acid.
| Compound Name | (2S,3S)-3-amino-4-[N-(carboxymethyl)anilino]-2-[2-[(4R)-4-[4-(diazenylmethyl)phenyl]-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57093916 |
| Molecular Formula | C27H30N6O8 |
| Molecular Weight | 566.57 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | (2S,3S)-3-amino-4-[N-(carboxymethyl)anilino]-2-[2-[(4R)-4-[4-(diazenylmethyl)phenyl]-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]-4-oxobutanoic acid |
| SMILES | [H]/N=N/Cc1ccc([C@]2(C)C(=O)N(CC(=O)[C@@H](C(=O)O)[C@H](N)C(=O)N(CC(=O)O)c3ccccc3)C(=O)N2CC)cc1 |
| InChI | InChI=1S/C27H30N6O8/c1-3-33-26(41)32(25(40)27(33,2)17-11-9-16(10-12-17)13-30-29)14-19(34)21(24(38)39)22(28)23(37)31(15-20(35)36)18-7-5-4-6-8-18/h4-12,21-22,29H,3,13-15,28H2,1-2H3,(H,35,36)(H,38,39)/b30-29+/t21-,22+,27-/m1/s1 |
| InChIKey | GUAGXVLDRHUPTC-UMGFEUQHSA-N |
| XLogP | 1.43 |
| TPSA | 214.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.57 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|