C33H28N4O2 — CID 22136703
7-[(3-benzyl-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)methyl]naphthalene-2-carboximidamide (PubChem CID 22136703) has the molecular formula C33H28N4O2 and a molecular weight of 512.61 g/mol. Its IUPAC name is 7-[(3-benzyl-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[(3-benzyl-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 22136703 |
| Molecular Formula | C33H28N4O2 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | 7-[(3-benzyl-4-methyl-4-naphthalen-2-yl-2,5-dioxoimidazolidin-1-yl)methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN3C(=O)N(Cc4ccccc4)C(C)(c4ccc5ccccc5c4)C3=O)cc2c1 |
| InChI | InChI=1S/C33H28N4O2/c1-33(29-16-15-24-9-5-6-10-26(24)19-29)31(38)36(32(39)37(33)21-22-7-3-2-4-8-22)20-23-11-12-25-13-14-27(30(34)35)18-28(25)17-23/h2-19H,20-21H2,1H3,(H3,34,35) |
| InChIKey | OFUVEXBRYFTMHF-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|