C29H32N4O4 — CID 139800660
methyl (3S,5S)-4-(aminomethyl)-5-(6-carbamimidoylnaphthalene-2-carbonyl)-3-methyl-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate (PubChem CID 139800660) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is methyl (3S,5S)-4-(aminomethyl)-5-(6-carbamimidoylnaphthalene-2-carbonyl)-3-methyl-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,5S)-4-(aminomethyl)-5-(6-carbamimidoylnaphthalene-2-carbonyl)-3-methyl-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139800660 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | methyl (3S,5S)-4-(aminomethyl)-5-(6-carbamimidoylnaphthalene-2-carbonyl)-3-methyl-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc2cc(C(=O)[C@@H]3C(CN)[C@](C)(C(=O)OC)C(=O)N3CCCc3ccccc3)ccc2c1 |
| InChI | InChI=1S/C29H32N4O4/c1-29(28(36)37-2)23(17-30)24(33(27(29)35)14-6-9-18-7-4-3-5-8-18)25(34)21-12-10-20-16-22(26(31)32)13-11-19(20)15-21/h3-5,7-8,10-13,15-16,23-24H,6,9,14,17,30H2,1-2H3,(H3,31,32)/t23?,24-,29-/m0/s1 |
| InChIKey | ATMDTJIIVKJMIU-MMTUGZBVSA-N |
| XLogP | 2.90 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|