C18H25NO6S — CID 139800645
methyl (3S,5S)-3,4-dimethyl-5-methylsulfonyloxy-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate (PubChem CID 139800645) has the molecular formula C18H25NO6S and a molecular weight of 383.47 g/mol. Its IUPAC name is methyl (3S,5S)-3,4-dimethyl-5-methylsulfonyloxy-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,5S)-3,4-dimethyl-5-methylsulfonyloxy-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 139800645 |
| Molecular Formula | C18H25NO6S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | methyl (3S,5S)-3,4-dimethyl-5-methylsulfonyloxy-2-oxo-1-(3-phenylpropyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@]1(C)C(=O)N(CCCc2ccccc2)[C@@H](OS(C)(=O)=O)C1C |
| InChI | InChI=1S/C18H25NO6S/c1-13-15(25-26(4,22)23)19(16(20)18(13,2)17(21)24-3)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,13,15H,8,11-12H2,1-4H3/t13?,15-,18-/m0/s1 |
| InChIKey | CMTXPRCGQBJEAM-ARJFZQPCSA-N |
| XLogP | 1.58 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|