C20H29NO6S — CID 57198466
methyl 4-[(3R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]butanoate (PubChem CID 57198466) has the molecular formula C20H29NO6S and a molecular weight of 411.52 g/mol. Its IUPAC name is methyl 4-[(3R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]butanoate.
| Compound Name | methyl 4-[(3R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 57198466 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl 4-[(3R,5S)-5-(methylsulfonyloxymethyl)-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]butanoate |
| SMILES | COC(=O)CCC[C@@H]1C[C@@H](COS(C)(=O)=O)N(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H29NO6S/c1-26-19(22)12-6-11-17-14-18(15-27-28(2,24)25)21(20(17)23)13-7-10-16-8-4-3-5-9-16/h3-5,8-9,17-18H,6-7,10-15H2,1-2H3/t17-,18+/m1/s1 |
| InChIKey | XNKGSQVVSPUVEP-MSOLQXFVSA-N |
| XLogP | 2.16 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|