C37H39NO2 — CID 57032456
(3R,5S)-3-but-3-enyl-1-(3-phenylpropyl)-5-(trityloxymethyl)pyrrolidin-2-one (PubChem CID 57032456) has the molecular formula C37H39NO2 and a molecular weight of 529.72 g/mol. Its IUPAC name is (3R,5S)-3-but-3-enyl-1-(3-phenylpropyl)-5-(trityloxymethyl)pyrrolidin-2-one.
| Compound Name | (3R,5S)-3-but-3-enyl-1-(3-phenylpropyl)-5-(trityloxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 57032456 |
| Molecular Formula | C37H39NO2 |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.30 |
| IUPAC Name | (3R,5S)-3-but-3-enyl-1-(3-phenylpropyl)-5-(trityloxymethyl)pyrrolidin-2-one |
| SMILES | C=CCC[C@@H]1C[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)N(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C37H39NO2/c1-2-3-20-31-28-35(38(36(31)39)27-16-19-30-17-8-4-9-18-30)29-40-37(32-21-10-5-11-22-32,33-23-12-6-13-24-33)34-25-14-7-15-26-34/h2,4-15,17-18,21-26,31,35H,1,3,16,19-20,27-29H2/t31-,35+/m1/s1 |
| InChIKey | BSJHTSPFVKFWLH-NQVJXQQZSA-N |
| XLogP | 7.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|