C28H28O — CID 101368856
[[(1R,2S)-2-[(1S,2S)-2-ethenylcyclopropyl]cyclopropyl]methoxy-diphenylmethyl]benzene (PubChem CID 101368856) has the molecular formula C28H28O and a molecular weight of 380.53 g/mol. Its IUPAC name is [[(1R,2S)-2-[(1S,2S)-2-ethenylcyclopropyl]cyclopropyl]methoxy-diphenylmethyl]benzene.
| Compound Name | [[(1R,2S)-2-[(1S,2S)-2-ethenylcyclopropyl]cyclopropyl]methoxy-diphenylmethyl]benzene |
|---|---|
| PubChem CID | 101368856 |
| Molecular Formula | C28H28O |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | [[(1R,2S)-2-[(1S,2S)-2-ethenylcyclopropyl]cyclopropyl]methoxy-diphenylmethyl]benzene |
| SMILES | C=C[C@@H]1C[C@@H]1[C@@H]1C[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H28O/c1-2-21-18-26(21)27-19-22(27)20-29-28(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h2-17,21-22,26-27H,1,18-20H2/t21-,22+,26+,27-/m1/s1 |
| InChIKey | CYRXWHKJYWJHMM-SDDHZKHCSA-N |
| XLogP | 6.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|