C50H44O3 — CID 10580518
(1R,2S,3S)-1-phenyl-2,3-bis(trityloxymethyl)cyclobutan-1-ol (PubChem CID 10580518) has the molecular formula C50H44O3 and a molecular weight of 692.90 g/mol. Its IUPAC name is (1R,2S,3S)-1-phenyl-2,3-bis(trityloxymethyl)cyclobutan-1-ol.
| Compound Name | (1R,2S,3S)-1-phenyl-2,3-bis(trityloxymethyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 10580518 |
| Molecular Formula | C50H44O3 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.33 |
| IUPAC Name | (1R,2S,3S)-1-phenyl-2,3-bis(trityloxymethyl)cyclobutan-1-ol |
| SMILES | O[C@]1(c2ccccc2)C[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)[C@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H44O3/c51-48(40-22-8-1-9-23-40)36-39(37-52-49(41-24-10-2-11-25-41,42-26-12-3-13-27-42)43-28-14-4-15-29-43)47(48)38-53-50(44-30-16-5-17-31-44,45-32-18-6-19-33-45)46-34-20-7-21-35-46/h1-35,39,47,51H,36-38H2/t39-,47-,48+/m1/s1 |
| InChIKey | ALTULILJIAHHMA-IMNXQNSSSA-N |
| XLogP | 10.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|