C15H14O — CID 165358316
cis-(1R,2R)-1,2-diphenylcyclopropan-1-ol (PubChem CID 165358316) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is cis-(1R,2R)-1,2-diphenylcyclopropan-1-ol.
| Compound Name | cis-(1R,2R)-1,2-diphenylcyclopropan-1-ol |
|---|---|
| PubChem CID | 165358316 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | cis-(1R,2R)-1,2-diphenylcyclopropan-1-ol |
| SMILES | O[C@]1(c2ccccc2)C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C15H14O/c16-15(13-9-5-2-6-10-13)11-14(15)12-7-3-1-4-8-12/h1-10,14,16H,11H2/t14-,15+/m1/s1 |
| InChIKey | MDNMSYSEHJNZFJ-CABCVRRESA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |