C19H24NO+ — CID 7071803
(2R,3R,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-ol (PubChem CID 7071803) has the molecular formula C19H24NO+ and a molecular weight of 282.41 g/mol. Its IUPAC name is (2R,3R,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-ol.
| Compound Name | (2R,3R,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7071803 |
| Molecular Formula | C19H24NO+ |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | (2R,3R,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-ol |
| SMILES | C[C@@H]1[C@H](c2ccccc2)[NH+](C)CC[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-15-18(16-9-5-3-6-10-16)20(2)14-13-19(15,21)17-11-7-4-8-12-17/h3-12,15,18,21H,13-14H2,1-2H3/p+1/t15-,18-,19-/m1/s1 |
| InChIKey | MIQQNFDIJGZCGD-ATZDWAIDSA-O |
| XLogP | 2.17 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |