C21H27N2O+ — CID 6935587
N-[(2R,3S,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-yl]acetamide (PubChem CID 6935587) has the molecular formula C21H27N2O+ and a molecular weight of 323.46 g/mol. Its IUPAC name is N-[(2R,3S,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-yl]acetamide.
| Compound Name | N-[(2R,3S,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-yl]acetamide |
|---|---|
| PubChem CID | 6935587 |
| Molecular Formula | C21H27N2O+ |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[(2R,3S,4R)-1,3-dimethyl-2,4-diphenylpiperidin-1-ium-4-yl]acetamide |
| SMILES | CC(=O)N[C@]1(c2ccccc2)CC[NH+](C)[C@@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C21H26N2O/c1-16-20(18-10-6-4-7-11-18)23(3)15-14-21(16,22-17(2)24)19-12-8-5-9-13-19/h4-13,16,20H,14-15H2,1-3H3,(H,22,24)/p+1/t16-,20+,21+/m0/s1 |
| InChIKey | LTMCHGVWSAGBIT-ZLGUVYLKSA-O |
| XLogP | 2.31 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |