C14H17NO3 — CID 815452
cis-(1R,3R)-3-acetamido-1-phenylcyclopentane-1-carboxylic acid (PubChem CID 815452) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is cis-(1R,3R)-3-acetamido-1-phenylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1R,3R)-3-acetamido-1-phenylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 815452 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | cis-(1R,3R)-3-acetamido-1-phenylcyclopentane-1-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1CC[C@](C(=O)O)(c2ccccc2)C1 |
| InChI | InChI=1S/C14H17NO3/c1-10(16)15-12-7-8-14(9-12,13(17)18)11-5-3-2-4-6-11/h2-6,12H,7-9H2,1H3,(H,15,16)(H,17,18)/t12-,14-/m1/s1 |
| InChIKey | BBNRPFXNYBFATO-TZMCWYRMSA-N |
| XLogP | 1.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |