About cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate
cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate (PubChem CID 6944468) has the molecular formula C18H18NO2-
and a molecular weight of 280.35 g/mol. Its IUPAC name is cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate |
| PubChem CID | 6944468 |
| Molecular Formula | C18H18NO2- |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate |
| SMILES | O=C([O-])[C@]1(c2ccccc2)CC[C@@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO2/c20-17(21)18(14-7-3-1-4-8-14)12-11-16(13-18)19-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,20,21)/p-1/t16-,18-/m1/s1 |
| InChIKey | HTLWNNFFJOTFAH-SJLPKXTDSA-M |
| XLogP | 2.34 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate?
The IUPAC name of cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate (CID 6944468) is cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate.
What is the SMILES notation for cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate?
The canonical SMILES for cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate is O=C([O-])[C@]1(c2ccccc2)CC[C@@H](Nc2ccccc2)C1.
What is the InChIKey of cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate?
The InChIKey is HTLWNNFFJOTFAH-SJLPKXTDSA-M. The full InChI is InChI=1S/C18H19NO2/c20-17(21)18(14-7-3-1-4-8-14)12-11-16(13-18)19-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,20,21)/p-1/t16-,18-/m1/s1.
What are the key properties of cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate?
cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate has a molecular weight of 280.35 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate is sourced from PubChem (CID 6944468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).