C18H18NO2- — CID 6944468
cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate (PubChem CID 6944468) has the molecular formula C18H18NO2- and a molecular weight of 280.35 g/mol. Its IUPAC name is cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate.
| Compound Name | cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 6944468 |
| Molecular Formula | C18H18NO2- |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | cis-(1R,3R)-3-anilino-1-phenylcyclopentane-1-carboxylate |
| SMILES | O=C([O-])[C@]1(c2ccccc2)CC[C@@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C18H19NO2/c20-17(21)18(14-7-3-1-4-8-14)12-11-16(13-18)19-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,20,21)/p-1/t16-,18-/m1/s1 |
| InChIKey | HTLWNNFFJOTFAH-SJLPKXTDSA-M |
| XLogP | 2.34 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |