C19H21N3O — CID 53185393
(1-phenylcyclopropyl)-[3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone (PubChem CID 53185393) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is (1-phenylcyclopropyl)-[3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone.
| Compound Name | (1-phenylcyclopropyl)-[3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 53185393 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (1-phenylcyclopropyl)-[3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCC(Nc2cccnc2)C1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C19H21N3O/c23-18(19(9-10-19)15-5-2-1-3-6-15)22-12-8-17(14-22)21-16-7-4-11-20-13-16/h1-7,11,13,17,21H,8-10,12,14H2 |
| InChIKey | OQPWNEVADPHIFO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |