C14H15N5O — CID 95107441
pyrazin-2-yl-[(3R)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone (PubChem CID 95107441) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is pyrazin-2-yl-[(3R)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone.
| Compound Name | pyrazin-2-yl-[(3R)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 95107441 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | pyrazin-2-yl-[(3R)-3-(pyridin-3-ylamino)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1cnccn1)N1CC[C@@H](Nc2cccnc2)C1 |
| InChI | InChI=1S/C14H15N5O/c20-14(13-9-16-5-6-17-13)19-7-3-12(10-19)18-11-2-1-4-15-8-11/h1-2,4-6,8-9,12,18H,3,7,10H2/t12-/m1/s1 |
| InChIKey | ZWEPDLWOUFJUDJ-GFCCVEGCSA-N |
| XLogP | 1.20 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |