C18H19NO2 — CID 101100863
N-(1-hydroxy-1-phenyl-3,4-dihydro-2H-naphthalen-2-yl)acetamide (PubChem CID 101100863) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is N-(1-hydroxy-1-phenyl-3,4-dihydro-2H-naphthalen-2-yl)acetamide.
| Compound Name | N-(1-hydroxy-1-phenyl-3,4-dihydro-2H-naphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 101100863 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(1-hydroxy-1-phenyl-3,4-dihydro-2H-naphthalen-2-yl)acetamide |
| SMILES | CC(=O)NC1CCc2ccccc2C1(O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-13(20)19-17-12-11-14-7-5-6-10-16(14)18(17,21)15-8-3-2-4-9-15/h2-10,17,21H,11-12H2,1H3,(H,19,20) |
| InChIKey | FYEAMWMDKGDKKN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |