C18H19NO3 — CID 101189373
ethyl N-[(2S,3S)-3-hydroxy-3-phenyl-1,2-dihydroinden-2-yl]carbamate (PubChem CID 101189373) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is ethyl N-[(2S,3S)-3-hydroxy-3-phenyl-1,2-dihydroinden-2-yl]carbamate.
| Compound Name | ethyl N-[(2S,3S)-3-hydroxy-3-phenyl-1,2-dihydroinden-2-yl]carbamate |
|---|---|
| PubChem CID | 101189373 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | ethyl N-[(2S,3S)-3-hydroxy-3-phenyl-1,2-dihydroinden-2-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1Cc2ccccc2[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3/c1-2-22-17(20)19-16-12-13-8-6-7-11-15(13)18(16,21)14-9-4-3-5-10-14/h3-11,16,21H,2,12H2,1H3,(H,19,20)/t16-,18-/m0/s1 |
| InChIKey | NUWBXLPELCAYBK-WMZOPIPTSA-N |
| XLogP | 2.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |