About ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate
ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate (PubChem CID 101097406) has the molecular formula C19H19NO4
and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate |
| PubChem CID | 101097406 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CC(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-23-18(22)20-16-13-17(21)24-19(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | KJKPANVGNMZDQB-INIZCTEOSA-N |
| XLogP | 2.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate?
The IUPAC name of ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate (CID 101097406) is ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate.
What is the SMILES notation for ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate?
The canonical SMILES for ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate is CCOC(=O)N[C@H]1CC(=O)OC1(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate?
The InChIKey is KJKPANVGNMZDQB-INIZCTEOSA-N. The full InChI is InChI=1S/C19H19NO4/c1-2-23-18(22)20-16-13-17(21)24-19(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,20,22)/t16-/m0/s1.
What are the key properties of ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate?
ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate has a molecular weight of 325.36 g/mol, XLogP of 2.99, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate is sourced from PubChem (CID 101097406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).