C19H19NO4 — CID 101097406
ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate (PubChem CID 101097406) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate.
| Compound Name | ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate |
|---|---|
| PubChem CID | 101097406 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | ethyl N-[(3S)-5-oxo-2,2-diphenyloxolan-3-yl]carbamate |
| SMILES | CCOC(=O)N[C@H]1CC(=O)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c1-2-23-18(22)20-16-13-17(21)24-19(16,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12,16H,2,13H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | KJKPANVGNMZDQB-INIZCTEOSA-N |
| XLogP | 2.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |