C13H14O5 — CID 10332326
ethyl (3R,4R)-4-hydroxy-5-oxo-3-phenyloxolane-3-carboxylate (PubChem CID 10332326) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl (3R,4R)-4-hydroxy-5-oxo-3-phenyloxolane-3-carboxylate.
| Compound Name | ethyl (3R,4R)-4-hydroxy-5-oxo-3-phenyloxolane-3-carboxylate |
|---|---|
| PubChem CID | 10332326 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | ethyl (3R,4R)-4-hydroxy-5-oxo-3-phenyloxolane-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(c2ccccc2)COC(=O)[C@@H]1O |
| InChI | InChI=1S/C13H14O5/c1-2-17-12(16)13(8-18-11(15)10(13)14)9-6-4-3-5-7-9/h3-7,10,14H,2,8H2,1H3/t10-,13-/m0/s1 |
| InChIKey | XKPYOZDATDQNJG-GWCFXTLKSA-N |
| XLogP | 0.41 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |