C20H32ClNO2 — CID 70344670
ethyl 2-[di(propan-2-yl)amino]-1-phenylcyclopentane-1-carboxylate;hydrochloride (PubChem CID 70344670) has the molecular formula C20H32ClNO2 and a molecular weight of 353.93 g/mol. Its IUPAC name is ethyl 2-[di(propan-2-yl)amino]-1-phenylcyclopentane-1-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[di(propan-2-yl)amino]-1-phenylcyclopentane-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 70344670 |
| Molecular Formula | C20H32ClNO2 |
| Molecular Weight | 353.93 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethyl 2-[di(propan-2-yl)amino]-1-phenylcyclopentane-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(c2ccccc2)CCCC1N(C(C)C)C(C)C.Cl |
| InChI | InChI=1S/C20H31NO2.ClH/c1-6-23-19(22)20(17-11-8-7-9-12-17)14-10-13-18(20)21(15(2)3)16(4)5;/h7-9,11-12,15-16,18H,6,10,13-14H2,1-5H3;1H |
| InChIKey | ZGZZCZBNSBOFOU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.93 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |