C20H31NO2 — CID 68914356
2-(2-amino-3-methyl-2-propan-2-ylbutyl)-1-phenylcyclopentane-1-carboxylic acid (PubChem CID 68914356) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is 2-(2-amino-3-methyl-2-propan-2-ylbutyl)-1-phenylcyclopentane-1-carboxylic acid.
| Compound Name | 2-(2-amino-3-methyl-2-propan-2-ylbutyl)-1-phenylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 68914356 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-(2-amino-3-methyl-2-propan-2-ylbutyl)-1-phenylcyclopentane-1-carboxylic acid |
| SMILES | CC(C)C(N)(CC1CCCC1(C(=O)O)c1ccccc1)C(C)C |
| InChI | InChI=1S/C20H31NO2/c1-14(2)20(21,15(3)4)13-17-11-8-12-19(17,18(22)23)16-9-6-5-7-10-16/h5-7,9-10,14-15,17H,8,11-13,21H2,1-4H3,(H,22,23) |
| InChIKey | LHWNSWHHLMXXKQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |