About diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate
diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate (PubChem CID 102204126) has the molecular formula C20H24O5
and a molecular weight of 344.41 g/mol. Its IUPAC name is diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate |
| PubChem CID | 102204126 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1CC(=O)C=C[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C20H24O5/c1-4-24-18(22)17(19(23)25-5-2)16-13-15(21)11-12-20(16,3)14-9-7-6-8-10-14/h6-12,16-17H,4-5,13H2,1-3H3/t16?,20-/m1/s1 |
| InChIKey | KEAADDPRMCRUFR-OTOKDRCRSA-N |
| XLogP | 2.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate?
The IUPAC name of diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate (CID 102204126) is diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate.
What is the SMILES notation for diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate?
The canonical SMILES for diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate is CCOC(=O)C(C(=O)OCC)C1CC(=O)C=C[C@]1(C)c1ccccc1.
What is the InChIKey of diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate?
The InChIKey is KEAADDPRMCRUFR-OTOKDRCRSA-N. The full InChI is InChI=1S/C20H24O5/c1-4-24-18(22)17(19(23)25-5-2)16-13-15(21)11-12-20(16,3)14-9-7-6-8-10-14/h6-12,16-17H,4-5,13H2,1-3H3/t16?,20-/m1/s1.
What are the key properties of diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate?
diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate has a molecular weight of 344.41 g/mol, XLogP of 2.83, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate is sourced from PubChem (CID 102204126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).