C20H24O5 — CID 102204126
diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate (PubChem CID 102204126) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate.
| Compound Name | diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate |
|---|---|
| PubChem CID | 102204126 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | diethyl 2-[(1R,2S)-2-methyl-5-oxo-2-phenylcyclohex-3-en-1-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C1CC(=O)C=C[C@]1(C)c1ccccc1 |
| InChI | InChI=1S/C20H24O5/c1-4-24-18(22)17(19(23)25-5-2)16-13-15(21)11-12-20(16,3)14-9-7-6-8-10-14/h6-12,16-17H,4-5,13H2,1-3H3/t16?,20-/m1/s1 |
| InChIKey | KEAADDPRMCRUFR-OTOKDRCRSA-N |
| XLogP | 2.83 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|