C11H16O5 — CID 90837162
ethyl 6-ethoxy-1-hydroxy-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 90837162) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is ethyl 6-ethoxy-1-hydroxy-4-oxocyclohex-2-ene-1-carboxylate.
| Compound Name | ethyl 6-ethoxy-1-hydroxy-4-oxocyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 90837162 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | ethyl 6-ethoxy-1-hydroxy-4-oxocyclohex-2-ene-1-carboxylate |
| SMILES | CCOC(=O)C1(O)C=CC(=O)CC1OCC |
| InChI | InChI=1S/C11H16O5/c1-3-15-9-7-8(12)5-6-11(9,14)10(13)16-4-2/h5-6,9,14H,3-4,7H2,1-2H3 |
| InChIKey | UJMKJWVIUUTAOD-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |