C14H18O5 — CID 101077995
ethyl (4aR)-2,2-dimethyl-4,7-dioxo-8,8a-dihydro-3H-chromene-4a-carboxylate (PubChem CID 101077995) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl (4aR)-2,2-dimethyl-4,7-dioxo-8,8a-dihydro-3H-chromene-4a-carboxylate.
| Compound Name | ethyl (4aR)-2,2-dimethyl-4,7-dioxo-8,8a-dihydro-3H-chromene-4a-carboxylate |
|---|---|
| PubChem CID | 101077995 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl (4aR)-2,2-dimethyl-4,7-dioxo-8,8a-dihydro-3H-chromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12C=CC(=O)CC1OC(C)(C)CC2=O |
| InChI | InChI=1S/C14H18O5/c1-4-18-12(17)14-6-5-9(15)7-11(14)19-13(2,3)8-10(14)16/h5-6,11H,4,7-8H2,1-3H3/t11?,14-/m0/s1 |
| InChIKey | QMJSOMUIHRDQRV-IAXJKZSUSA-N |
| XLogP | 1.20 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|