C15H22O5 — CID 101078009
ethyl (4R,4aS,8S)-4-hydroxy-2,2,8-trimethyl-7-oxo-3,4,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 101078009) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl (4R,4aS,8S)-4-hydroxy-2,2,8-trimethyl-7-oxo-3,4,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4R,4aS,8S)-4-hydroxy-2,2,8-trimethyl-7-oxo-3,4,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 101078009 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | ethyl (4R,4aS,8S)-4-hydroxy-2,2,8-trimethyl-7-oxo-3,4,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12C=CC(=O)[C@@H](C)C1OC(C)(C)C[C@H]2O |
| InChI | InChI=1S/C15H22O5/c1-5-19-13(18)15-7-6-10(16)9(2)12(15)20-14(3,4)8-11(15)17/h6-7,9,11-12,17H,5,8H2,1-4H3/t9-,11-,12?,15+/m1/s1 |
| InChIKey | UNDICGKHYKIKNB-ZSFDMHAASA-N |
| XLogP | 1.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |