C14H24O4 — CID 143831911
diethyl 1,2,3-trimethylcyclopentane-1,3-dicarboxylate (PubChem CID 143831911) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is diethyl 1,2,3-trimethylcyclopentane-1,3-dicarboxylate.
| Compound Name | diethyl 1,2,3-trimethylcyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 143831911 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | diethyl 1,2,3-trimethylcyclopentane-1,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C)CCC(C)(C(=O)OCC)C1C |
| InChI | InChI=1S/C14H24O4/c1-6-17-11(15)13(4)8-9-14(5,10(13)3)12(16)18-7-2/h10H,6-9H2,1-5H3 |
| InChIKey | FCWPZKOFTRNECB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |