About ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate
ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate (PubChem CID 159386259) has the molecular formula C21H38O5
and a molecular weight of 370.53 g/mol. Its IUPAC name is ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate |
| PubChem CID | 159386259 |
| Molecular Formula | C21H38O5 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.27 |
| IUPAC Name | ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CCC(C)CC1.CCOC(=O)C1(C)CCC(O)CC1 |
| InChI | InChI=1S/C11H20O2.C10H18O3/c1-4-13-10(12)11(3)7-5-9(2)6-8-11;1-3-13-9(12)10(2)6-4-8(11)5-7-10/h9H,4-8H2,1-3H3;8,11H,3-7H2,1-2H3 |
| InChIKey | LLNLTOZDPKDIGR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The IUPAC name of ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate (CID 159386259) is ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate.
What is the SMILES notation for ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The canonical SMILES for ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate is CCOC(=O)C1(C)CCC(C)CC1.CCOC(=O)C1(C)CCC(O)CC1.
What is the InChIKey of ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
The InChIKey is LLNLTOZDPKDIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2.C10H18O3/c1-4-13-10(12)11(3)7-5-9(2)6-8-11;1-3-13-9(12)10(2)6-4-8(11)5-7-10/h9H,4-8H2,1-3H3;8,11H,3-7H2,1-2H3.
What are the key properties of ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate?
ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate has a molecular weight of 370.53 g/mol, XLogP of 4.26, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1,4-dimethylcyclohexane-1-carboxylate;ethyl 4-hydroxy-1-methylcyclohexane-1-carboxylate is sourced from PubChem (CID 159386259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).