C36H55NO11 — CID 158434680
(4-ethoxycarbonyl-4-methylcyclohexyl) 4-nitrobenzoate;ethyl 1,4-dimethylcyclohexane-1-carboxylate;4-hydroxy-1-methylcyclohexane-1-carboxylic acid (PubChem CID 158434680) has the molecular formula C36H55NO11 and a molecular weight of 677.83 g/mol. Its IUPAC name is (4-ethoxycarbonyl-4-methylcyclohexyl) 4-nitrobenzoate;ethyl 1,4-dimethylcyclohexane-1-carboxylate;4-hydroxy-1-methylcyclohexane-1-carboxylic acid.
| Compound Name | (4-ethoxycarbonyl-4-methylcyclohexyl) 4-nitrobenzoate;ethyl 1,4-dimethylcyclohexane-1-carboxylate;4-hydroxy-1-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 158434680 |
| Molecular Formula | C36H55NO11 |
| Molecular Weight | 677.83 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | (4-ethoxycarbonyl-4-methylcyclohexyl) 4-nitrobenzoate;ethyl 1,4-dimethylcyclohexane-1-carboxylate;4-hydroxy-1-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC(O)CC1.CCOC(=O)C1(C)CCC(C)CC1.CCOC(=O)C1(C)CCC(OC(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C17H21NO6.C11H20O2.C8H14O3/c1-3-23-16(20)17(2)10-8-14(9-11-17)24-15(19)12-4-6-13(7-5-12)18(21)22;1-4-13-10(12)11(3)7-5-9(2)6-8-11;1-8(7(10)11)4-2-6(9)3-5-8/h4-7,14H,3,8-11H2,1-2H3;9H,4-8H2,1-3H3;6,9H,2-5H2,1H3,(H,10,11) |
| InChIKey | HCBSZYHRKNQASW-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 179.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.83 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|