C15H19N2O4+ — CID 11860372
[(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate (PubChem CID 11860372) has the molecular formula C15H19N2O4+ and a molecular weight of 291.33 g/mol. Its IUPAC name is [(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate.
| Compound Name | [(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 11860372 |
| Molecular Formula | C15H19N2O4+ |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | [(1S,5R)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate |
| SMILES | C[NH+]1[C@@H]2CC[C@H]1CC(OC(=O)c1ccc([N+](=O)[O-])cc1)C2 |
| InChI | InChI=1S/C15H18N2O4/c1-16-12-6-7-13(16)9-14(8-12)21-15(18)10-2-4-11(5-3-10)17(19)20/h2-5,12-14H,6-9H2,1H3/p+1/t12-,13+,14? |
| InChIKey | CAPVXZJKYMHZKL-PBWFPOADSA-O |
| XLogP | 0.96 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|