C20H21NO5 — CID 68798263
[3-[(1S)-1-phenylmethoxyethyl]cyclobutyl] 4-nitrobenzoate (PubChem CID 68798263) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is [3-[(1S)-1-phenylmethoxyethyl]cyclobutyl] 4-nitrobenzoate.
| Compound Name | [3-[(1S)-1-phenylmethoxyethyl]cyclobutyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 68798263 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [3-[(1S)-1-phenylmethoxyethyl]cyclobutyl] 4-nitrobenzoate |
| SMILES | C[C@H](OCc1ccccc1)C1CC(OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H21NO5/c1-14(25-13-15-5-3-2-4-6-15)17-11-19(12-17)26-20(22)16-7-9-18(10-8-16)21(23)24/h2-10,14,17,19H,11-13H2,1H3/t14-,17?,19?/m0/s1 |
| InChIKey | XCPFHUVXYKLGHK-STJZUHDESA-N |
| XLogP | 4.14 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|