About (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate
(3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate (PubChem CID 160721887) has the molecular formula C15H19NO7
and a molecular weight of 325.32 g/mol. Its IUPAC name is (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate.
Molecular Properties
| Compound Name | (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate |
| PubChem CID | 160721887 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@@H]1CCOC1)c1ccc([N+](=O)[O-])cc1.O[C@@H]1CCOC1 |
| InChI | InChI=1S/C11H11NO5.C4H8O2/c13-11(17-10-5-6-16-7-10)8-1-3-9(4-2-8)12(14)15;5-4-1-2-6-3-4/h1-4,10H,5-7H2;4-5H,1-3H2/t10-;4-/m11/s1 |
| InChIKey | RTFBMVJQOYJBNT-YRKUKBCSSA-N |
| XLogP | 1.31 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate?
The IUPAC name of (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate (CID 160721887) is (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate.
What is the SMILES notation for (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate?
The canonical SMILES for (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate is O=C(O[C@@H]1CCOC1)c1ccc([N+](=O)[O-])cc1.O[C@@H]1CCOC1.
What is the InChIKey of (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate?
The InChIKey is RTFBMVJQOYJBNT-YRKUKBCSSA-N. The full InChI is InChI=1S/C11H11NO5.C4H8O2/c13-11(17-10-5-6-16-7-10)8-1-3-9(4-2-8)12(14)15;5-4-1-2-6-3-4/h1-4,10H,5-7H2;4-5H,1-3H2/t10-;4-/m11/s1.
What are the key properties of (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate?
(3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate has a molecular weight of 325.32 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-oxolan-3-ol;[(3R)-oxolan-3-yl] 4-nitrobenzoate is sourced from PubChem (CID 160721887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).