About oxolan-3-yl 4-fluorobenzoate
oxolan-3-yl 4-fluorobenzoate (PubChem CID 63663417) has the molecular formula C11H11FO3
and a molecular weight of 210.20 g/mol. Its IUPAC name is oxolan-3-yl 4-fluorobenzoate.
Molecular Properties
| Compound Name | oxolan-3-yl 4-fluorobenzoate |
| PubChem CID | 63663417 |
| Molecular Formula | C11H11FO3 |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | oxolan-3-yl 4-fluorobenzoate |
| SMILES | O=C(OC1CCOC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FO3/c12-9-3-1-8(2-4-9)11(13)15-10-5-6-14-7-10/h1-4,10H,5-7H2 |
| InChIKey | YVHQWCMTPQFGBT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze oxolan-3-yl 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolan-3-yl 4-fluorobenzoate?
The IUPAC name of oxolan-3-yl 4-fluorobenzoate (CID 63663417) is oxolan-3-yl 4-fluorobenzoate.
What is the SMILES notation for oxolan-3-yl 4-fluorobenzoate?
The canonical SMILES for oxolan-3-yl 4-fluorobenzoate is O=C(OC1CCOC1)c1ccc(F)cc1.
What is the InChIKey of oxolan-3-yl 4-fluorobenzoate?
The InChIKey is YVHQWCMTPQFGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO3/c12-9-3-1-8(2-4-9)11(13)15-10-5-6-14-7-10/h1-4,10H,5-7H2.
What are the key properties of oxolan-3-yl 4-fluorobenzoate?
oxolan-3-yl 4-fluorobenzoate has a molecular weight of 210.20 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxolan-3-yl 4-fluorobenzoate is sourced from PubChem (CID 63663417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).