About ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane
ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane (PubChem CID 142438427) has the molecular formula C13H28O2
and a molecular weight of 216.36 g/mol. Its IUPAC name is ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane.
Molecular Properties
| Compound Name | ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane |
| PubChem CID | 142438427 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane |
| SMILES | C.CC.CCOC(=O)C1(C)CCCCC1 |
| InChI | InChI=1S/C10H18O2.C2H6.CH4/c1-3-12-9(11)10(2)7-5-4-6-8-10;1-2;/h3-8H2,1-2H3;1-2H3;1H4 |
| InChIKey | LEUZIJVIGIQWFQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane?
The IUPAC name of ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane (CID 142438427) is ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane.
What is the SMILES notation for ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane?
The canonical SMILES for ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane is C.CC.CCOC(=O)C1(C)CCCCC1.
What is the InChIKey of ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane?
The InChIKey is LEUZIJVIGIQWFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C2H6.CH4/c1-3-12-9(11)10(2)7-5-4-6-8-10;1-2;/h3-8H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane?
ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane has a molecular weight of 216.36 g/mol, XLogP of 4.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl 1-methylcyclohexane-1-carboxylate;methane is sourced from PubChem (CID 142438427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).