About 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate
2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate (PubChem CID 171620099) has the molecular formula C10H16O2S
and a molecular weight of 200.30 g/mol. Its IUPAC name is 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate |
| PubChem CID | 171620099 |
| Molecular Formula | C10H16O2S |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate |
| SMILES | CC(=S)COC(=O)C1(C)CCCC1 |
| InChI | InChI=1S/C10H16O2S/c1-8(13)7-12-9(11)10(2)5-3-4-6-10/h3-7H2,1-2H3 |
| InChIKey | QJPZMOJTJUHQNR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate?
The IUPAC name of 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate (CID 171620099) is 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate.
What is the SMILES notation for 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate?
The canonical SMILES for 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate is CC(=S)COC(=O)C1(C)CCCC1.
What is the InChIKey of 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate?
The InChIKey is QJPZMOJTJUHQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S/c1-8(13)7-12-9(11)10(2)5-3-4-6-10/h3-7H2,1-2H3.
What are the key properties of 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate?
2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate has a molecular weight of 200.30 g/mol, XLogP of 2.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidenepropyl 1-methylcyclopentane-1-carboxylate is sourced from PubChem (CID 171620099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).