About amino 1-methylcyclobutane-1-carboxylate
amino 1-methylcyclobutane-1-carboxylate (PubChem CID 118650496) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is amino 1-methylcyclobutane-1-carboxylate.
Molecular Properties
| Compound Name | amino 1-methylcyclobutane-1-carboxylate |
| PubChem CID | 118650496 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | amino 1-methylcyclobutane-1-carboxylate |
| SMILES | CC1(C(=O)ON)CCC1 |
| InChI | InChI=1S/C6H11NO2/c1-6(3-2-4-6)5(8)9-7/h2-4,7H2,1H3 |
| InChIKey | NOPQWEUFENKFFU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 1-methylcyclobutane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 1-methylcyclobutane-1-carboxylate?
The IUPAC name of amino 1-methylcyclobutane-1-carboxylate (CID 118650496) is amino 1-methylcyclobutane-1-carboxylate.
What is the SMILES notation for amino 1-methylcyclobutane-1-carboxylate?
The canonical SMILES for amino 1-methylcyclobutane-1-carboxylate is CC1(C(=O)ON)CCC1.
What is the InChIKey of amino 1-methylcyclobutane-1-carboxylate?
The InChIKey is NOPQWEUFENKFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-6(3-2-4-6)5(8)9-7/h2-4,7H2,1H3.
What are the key properties of amino 1-methylcyclobutane-1-carboxylate?
amino 1-methylcyclobutane-1-carboxylate has a molecular weight of 129.16 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino 1-methylcyclobutane-1-carboxylate is sourced from PubChem (CID 118650496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).