C9H11NO3 — CID 23496771
ethyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-1-carboxylate (PubChem CID 23496771) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is ethyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-1-carboxylate.
| Compound Name | ethyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-1-carboxylate |
|---|---|
| PubChem CID | 23496771 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | ethyl 3-oxo-2-azabicyclo[2.2.1]hept-5-ene-1-carboxylate |
| SMILES | CCOC(=O)C12C=CC(C1)C(=O)N2 |
| InChI | InChI=1S/C9H11NO3/c1-2-13-8(12)9-4-3-6(5-9)7(11)10-9/h3-4,6H,2,5H2,1H3,(H,10,11) |
| InChIKey | HHVAVEFONHDKNL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|