C10H15ClO3 — CID 130891027
trans-ethyl (1S,5R)-5-chloro-1-methyl-2-oxocyclohexane-1-carboxylate (PubChem CID 130891027) has the molecular formula C10H15ClO3 and a molecular weight of 218.68 g/mol. Its IUPAC name is trans-ethyl (1S,5R)-5-chloro-1-methyl-2-oxocyclohexane-1-carboxylate.
| Compound Name | trans-ethyl (1S,5R)-5-chloro-1-methyl-2-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 130891027 |
| Molecular Formula | C10H15ClO3 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | trans-ethyl (1S,5R)-5-chloro-1-methyl-2-oxocyclohexane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C)C[C@H](Cl)CCC1=O |
| InChI | InChI=1S/C10H15ClO3/c1-3-14-9(13)10(2)6-7(11)4-5-8(10)12/h7H,3-6H2,1-2H3/t7-,10+/m1/s1 |
| InChIKey | PRFSFQHUEUXIAY-XCBNKYQSSA-N |
| XLogP | 1.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|