C10H14O4 — CID 54363469
ethyl 1,4-dimethyl-2,3-dioxocyclopentane-1-carboxylate (PubChem CID 54363469) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is ethyl 1,4-dimethyl-2,3-dioxocyclopentane-1-carboxylate.
| Compound Name | ethyl 1,4-dimethyl-2,3-dioxocyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 54363469 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | ethyl 1,4-dimethyl-2,3-dioxocyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C)CC(C)C(=O)C1=O |
| InChI | InChI=1S/C10H14O4/c1-4-14-9(13)10(3)5-6(2)7(11)8(10)12/h6H,4-5H2,1-3H3 |
| InChIKey | UOCUUHOGKFBXQZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|