C9H15NO3 — CID 20603009
ethyl 1,3-dimethyl-4-oxopyrrolidine-3-carboxylate (PubChem CID 20603009) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is ethyl 1,3-dimethyl-4-oxopyrrolidine-3-carboxylate.
| Compound Name | ethyl 1,3-dimethyl-4-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 20603009 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | ethyl 1,3-dimethyl-4-oxopyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)C1(C)CN(C)CC1=O |
| InChI | InChI=1S/C9H15NO3/c1-4-13-8(12)9(2)6-10(3)5-7(9)11/h4-6H2,1-3H3 |
| InChIKey | PZXXSEFHBIYOHN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|