C12H18O5 — CID 163379847
diethyl 2,4-dimethyl-2H-furan-5,5-dicarboxylate (PubChem CID 163379847) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is diethyl 2,4-dimethyl-2H-furan-5,5-dicarboxylate.
| Compound Name | diethyl 2,4-dimethyl-2H-furan-5,5-dicarboxylate |
|---|---|
| PubChem CID | 163379847 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | diethyl 2,4-dimethyl-2H-furan-5,5-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)OC(C)C=C1C |
| InChI | InChI=1S/C12H18O5/c1-5-15-10(13)12(11(14)16-6-2)8(3)7-9(4)17-12/h7,9H,5-6H2,1-4H3 |
| InChIKey | JPTFHYTVYJZOFK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|